C11H18N2O6S2 — CID 163993084
2-amino-3-[[(Z)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethenyl]disulfanyl]propanoic acid (PubChem CID 163993084) has the molecular formula C11H18N2O6S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-amino-3-[[(Z)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethenyl]disulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[(Z)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethenyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 163993084 |
| Molecular Formula | C11H18N2O6S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-amino-3-[[(Z)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethenyl]disulfanyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=C\SSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O6S2/c1-11(2,3)19-10(18)13-7(9(16)17)5-21-20-4-6(12)8(14)15/h5-6H,4,12H2,1-3H3,(H,13,18)(H,14,15)(H,16,17)/b7-5- |
| InChIKey | UCIXVCURUPCPIT-ALCCZGGFSA-N |
| XLogP | 1.23 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|