C11H20N2O6S2 — CID 175035908
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 175035908) has the molecular formula C11H20N2O6S2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175035908 |
| Molecular Formula | C11H20N2O6S2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)C(SSCC(N)C(=O)O)C(N)C(=O)O |
| InChI | InChI=1S/C11H20N2O6S2/c1-11(2,3)19-10(18)7(6(13)9(16)17)21-20-4-5(12)8(14)15/h5-7H,4,12-13H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | QWQSYYNNSKGRHR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|