C10H18N4O6S2 — CID 90189413
(2R)-2-amino-5-[(2-aminoacetyl)amino]-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-4-oxopentanoic acid (PubChem CID 90189413) has the molecular formula C10H18N4O6S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2R)-2-amino-5-[(2-aminoacetyl)amino]-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-4-oxopentanoic acid.
| Compound Name | (2R)-2-amino-5-[(2-aminoacetyl)amino]-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 90189413 |
| Molecular Formula | C10H18N4O6S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (2R)-2-amino-5-[(2-aminoacetyl)amino]-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-4-oxopentanoic acid |
| SMILES | NCC(=O)NCC(=O)C(SSC[C@H](N)C(=O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H18N4O6S2/c11-1-6(16)14-2-5(15)8(7(13)10(19)20)22-21-3-4(12)9(17)18/h4,7-8H,1-3,11-13H2,(H,14,16)(H,17,18)(H,19,20)/t4-,7-,8?/m0/s1 |
| InChIKey | JDGGWBHVDRVPSH-IEGHYIRPSA-N |
| XLogP | -2.80 |
| TPSA | 198.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|