C10H12O2 — CID 163998934
7-hydroxy-6-methyl-2,3,7,7a-tetrahydroinden-1-one (PubChem CID 163998934) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 7-hydroxy-6-methyl-2,3,7,7a-tetrahydroinden-1-one.
| Compound Name | 7-hydroxy-6-methyl-2,3,7,7a-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 163998934 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 7-hydroxy-6-methyl-2,3,7,7a-tetrahydroinden-1-one |
| SMILES | CC1=CC=C2CCC(=O)C2C1O |
| InChI | InChI=1S/C10H12O2/c1-6-2-3-7-4-5-8(11)9(7)10(6)12/h2-3,9-10,12H,4-5H2,1H3 |
| InChIKey | UHFFZPAHDVJWBJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |