C52H89NO9 — CID 164552762
4-[4-[6-[(E)-hex-2-enoxy]-6-oct-3-ynoxyhexanoyl]oxybutyl-(2-hydroxyethyl)amino]butyl 6,6-bis(oct-3-ynoxy)hexanoate (PubChem CID 164552762) has the molecular formula C52H89NO9 and a molecular weight of 872.28 g/mol. Its IUPAC name is 4-[4-[6-[(E)-hex-2-enoxy]-6-oct-3-ynoxyhexanoyl]oxybutyl-(2-hydroxyethyl)amino]butyl 6,6-bis(oct-3-ynoxy)hexanoate.
| Compound Name | 4-[4-[6-[(E)-hex-2-enoxy]-6-oct-3-ynoxyhexanoyl]oxybutyl-(2-hydroxyethyl)amino]butyl 6,6-bis(oct-3-ynoxy)hexanoate |
|---|---|
| PubChem CID | 164552762 |
| Molecular Formula | C52H89NO9 |
| Molecular Weight | 872.28 g/mol |
| Exact Mass | 871.65 |
| IUPAC Name | 4-[4-[6-[(E)-hex-2-enoxy]-6-oct-3-ynoxyhexanoyl]oxybutyl-(2-hydroxyethyl)amino]butyl 6,6-bis(oct-3-ynoxy)hexanoate |
| SMILES | CCC/C=C/COC(CCCCC(=O)OCCCCN(CCO)CCCCOC(=O)CCCCC(OCCC#CCCCC)OCCC#CCCCC)OCCC#CCCCC |
| InChI | InChI=1S/C52H89NO9/c1-5-9-13-17-20-30-46-60-51(59-45-29-16-12-8-4)37-25-23-35-49(55)57-43-33-27-39-53(41-42-54)40-28-34-44-58-50(56)36-24-26-38-52(61-47-31-21-18-14-10-6-2)62-48-32-22-19-15-11-7-3/h16,29,51-52,54H,5-15,23-28,30-48H2,1-4H3/b29-16+ |
| InChIKey | RDUSJPJGNHUTEZ-MUFRIFMGSA-N |
| XLogP | 10.87 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.28 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|