C15H15BrO2 — CID 164583447
2'-bromo-5'-methoxyspiro[cyclohexane-4,1'-indene]-1-one (PubChem CID 164583447) has the molecular formula C15H15BrO2 and a molecular weight of 307.19 g/mol. Its IUPAC name is 2'-bromo-5'-methoxyspiro[cyclohexane-4,1'-indene]-1-one.
| Compound Name | 2'-bromo-5'-methoxyspiro[cyclohexane-4,1'-indene]-1-one |
|---|---|
| PubChem CID | 164583447 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2'-bromo-5'-methoxyspiro[cyclohexane-4,1'-indene]-1-one |
| SMILES | COc1ccc2c(c1)C=C(Br)C21CCC(=O)CC1 |
| InChI | InChI=1S/C15H15BrO2/c1-18-12-2-3-13-10(8-12)9-14(16)15(13)6-4-11(17)5-7-15/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | GLRJZRCHBZNXBD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |