C9H9N2O+ — CID 164587546
1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-3-carbonitrile (PubChem CID 164587546) has the molecular formula C9H9N2O+ and a molecular weight of 161.18 g/mol. Its IUPAC name is 1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-3-carbonitrile.
| Compound Name | 1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 164587546 |
| Molecular Formula | C9H9N2O+ |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-3-carbonitrile |
| SMILES | N#Cc1cc2c([n+](O)c1)CCC2 |
| InChI | InChI=1S/C9H9N2O/c10-5-7-4-8-2-1-3-9(8)11(12)6-7/h4,6,12H,1-3H2/q+1 |
| InChIKey | QLJKDIVPLHUAMD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|