C10H10BrN2O+ — CID 166728153
2-bromo-1-hydroxy-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile (PubChem CID 166728153) has the molecular formula C10H10BrN2O+ and a molecular weight of 254.11 g/mol. Its IUPAC name is 2-bromo-1-hydroxy-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile.
| Compound Name | 2-bromo-1-hydroxy-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 166728153 |
| Molecular Formula | C10H10BrN2O+ |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-bromo-1-hydroxy-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile |
| SMILES | N#Cc1cc2c([n+](O)c1Br)CCCC2 |
| InChI | InChI=1S/C10H10BrN2O/c11-10-8(6-12)5-7-3-1-2-4-9(7)13(10)14/h5,14H,1-4H2/q+1 |
| InChIKey | ZJFQTRJANGDIPE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|