C23H37N3O2 — CID 164604774
6-benzyl-N-[2-(2-ethylpentoxy)ethyl]-2,6-diazaspiro[3.4]octane-8-carboxamide (PubChem CID 164604774) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 6-benzyl-N-[2-(2-ethylpentoxy)ethyl]-2,6-diazaspiro[3.4]octane-8-carboxamide.
| Compound Name | 6-benzyl-N-[2-(2-ethylpentoxy)ethyl]-2,6-diazaspiro[3.4]octane-8-carboxamide |
|---|---|
| PubChem CID | 164604774 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 6-benzyl-N-[2-(2-ethylpentoxy)ethyl]-2,6-diazaspiro[3.4]octane-8-carboxamide |
| SMILES | CCCC(CC)COCCNC(=O)C1CN(Cc2ccccc2)CC12CNC2 |
| InChI | InChI=1S/C23H37N3O2/c1-3-8-19(4-2)15-28-12-11-25-22(27)21-14-26(18-23(21)16-24-17-23)13-20-9-6-5-7-10-20/h5-7,9-10,19,21,24H,3-4,8,11-18H2,1-2H3,(H,25,27) |
| InChIKey | IVANFYVPKFMXMD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|