C19H18F2N4O5 — CID 164629041
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-hydroxyethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione (PubChem CID 164629041) has the molecular formula C19H18F2N4O5 and a molecular weight of 420.37 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-hydroxyethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-hydroxyethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
|---|---|
| PubChem CID | 164629041 |
| Molecular Formula | C19H18F2N4O5 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-hydroxyethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(CCO)C2=O)CC(=O)N4)c1F |
| InChI | InChI=1S/C19H18F2N4O5/c1-29-11-6-12(30-2)15(21)17(14(11)20)25-8-9-7-22-18-10(5-13(27)23-18)16(9)24(3-4-26)19(25)28/h6-7,26H,3-5,8H2,1-2H3,(H,22,23,27) |
| InChIKey | KVWWZCOLUCFTMQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |