C41H65NO5Si — CID 164667855
tert-butyl (2S,3R,4aS,5S,8aR)-5-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyoctyl]-3-(methoxymethoxy)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 164667855) has the molecular formula C41H65NO5Si and a molecular weight of 680.06 g/mol. Its IUPAC name is tert-butyl (2S,3R,4aS,5S,8aR)-5-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyoctyl]-3-(methoxymethoxy)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,4aS,5S,8aR)-5-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyoctyl]-3-(methoxymethoxy)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 164667855 |
| Molecular Formula | C41H65NO5Si |
| Molecular Weight | 680.06 g/mol |
| Exact Mass | 679.46 |
| IUPAC Name | tert-butyl (2S,3R,4aS,5S,8aR)-5-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyoctyl]-3-(methoxymethoxy)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | CCC[C@H](CCCC[C@H]1CCC[C@@H]2[C@H]1C[C@@H](OCOC)[C@H](C)N2C(=O)OC(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H65NO5Si/c1-10-20-33(47-48(41(6,7)8,34-24-13-11-14-25-34)35-26-15-12-16-27-35)23-18-17-21-32-22-19-28-37-36(32)29-38(45-30-44-9)31(2)42(37)39(43)46-40(3,4)5/h11-16,24-27,31-33,36-38H,10,17-23,28-30H2,1-9H3/t31-,32-,33+,36-,37+,38+/m0/s1 |
| InChIKey | WRAWEMROBXFRHT-FEFWWZSSSA-N |
| XLogP | 9.10 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.06 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|