C36H30 — CID 164679247
1,3-dimethyl-5-[(1Z,3Z)-1,2,3,4-tetraphenylbuta-1,3-dienyl]benzene (PubChem CID 164679247) has the molecular formula C36H30 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(1Z,3Z)-1,2,3,4-tetraphenylbuta-1,3-dienyl]benzene.
| Compound Name | 1,3-dimethyl-5-[(1Z,3Z)-1,2,3,4-tetraphenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 164679247 |
| Molecular Formula | C36H30 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1,3-dimethyl-5-[(1Z,3Z)-1,2,3,4-tetraphenylbuta-1,3-dienyl]benzene |
| SMILES | Cc1cc(C)cc(/C(=C(C(=C/c2ccccc2)\c2ccccc2)/c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H30/c1-27-23-28(2)25-33(24-27)35(31-19-11-5-12-20-31)36(32-21-13-6-14-22-32)34(30-17-9-4-10-18-30)26-29-15-7-3-8-16-29/h3-26H,1-2H3/b34-26-,36-35- |
| InChIKey | WINIGDDSUIDPSD-MCXBGMJKSA-N |
| XLogP | 9.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|