C21H30Br3N6O7P — CID 164685152
2-[6-(3-methylbut-3-enylamino)purin-9-yl]-5-[[morpholin-4-yl(2,2,2-tribromoethoxy)phosphoryl]oxymethyl]oxolane-3,4-diol (PubChem CID 164685152) has the molecular formula C21H30Br3N6O7P and a molecular weight of 749.19 g/mol. Its IUPAC name is 2-[6-(3-methylbut-3-enylamino)purin-9-yl]-5-[[morpholin-4-yl(2,2,2-tribromoethoxy)phosphoryl]oxymethyl]oxolane-3,4-diol.
| Compound Name | 2-[6-(3-methylbut-3-enylamino)purin-9-yl]-5-[[morpholin-4-yl(2,2,2-tribromoethoxy)phosphoryl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 164685152 |
| Molecular Formula | C21H30Br3N6O7P |
| Molecular Weight | 749.19 g/mol |
| Exact Mass | 745.95 |
| IUPAC Name | 2-[6-(3-methylbut-3-enylamino)purin-9-yl]-5-[[morpholin-4-yl(2,2,2-tribromoethoxy)phosphoryl]oxymethyl]oxolane-3,4-diol |
| SMILES | C=C(C)CCNc1ncnc2c1ncn2C1OC(COP(=O)(OCC(Br)(Br)Br)N2CCOCC2)C(O)C1O |
| InChI | InChI=1S/C21H30Br3N6O7P/c1-13(2)3-4-25-18-15-19(27-11-26-18)30(12-28-15)20-17(32)16(31)14(37-20)9-35-38(33,36-10-21(22,23)24)29-5-7-34-8-6-29/h11-12,14,16-17,20,31-32H,1,3-10H2,2H3,(H,25,26,27) |
| InChIKey | SQPWDLDYAWIRBX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|