C39H51NO12S — CID 164717657
[4-[bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-nitrooxy-λ4-sulfanyl]-2,6-dimethylphenyl] tert-butyl carbonate (PubChem CID 164717657) has the molecular formula C39H51NO12S and a molecular weight of 757.90 g/mol. Its IUPAC name is [4-[bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-nitrooxy-λ4-sulfanyl]-2,6-dimethylphenyl] tert-butyl carbonate.
| Compound Name | [4-[bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-nitrooxy-λ4-sulfanyl]-2,6-dimethylphenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 164717657 |
| Molecular Formula | C39H51NO12S |
| Molecular Weight | 757.90 g/mol |
| Exact Mass | 757.31 |
| IUPAC Name | [4-[bis[3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-nitrooxy-λ4-sulfanyl]-2,6-dimethylphenyl] tert-butyl carbonate |
| SMILES | Cc1cc(S(O[N+](=O)[O-])(c2cc(C)c(OC(=O)OC(C)(C)C)c(C)c2)c2cc(C)c(OC(=O)OC(C)(C)C)c(C)c2)cc(C)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H51NO12S/c1-22-16-28(17-23(2)31(22)46-34(41)49-37(7,8)9)53(52-40(44)45,29-18-24(3)32(25(4)19-29)47-35(42)50-38(10,11)12)30-20-26(5)33(27(6)21-30)48-36(43)51-39(13,14)15/h16-21H,1-15H3 |
| InChIKey | AOCLHTNDQUOSPW-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 158.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.90 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|