C17H21F3N4O2S — CID 164725532
[(2'S,6'S,7S)-2'-methyl-6'-(1-methyltriazol-4-yl)-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-3-yl]methanol (PubChem CID 164725532) has the molecular formula C17H21F3N4O2S and a molecular weight of 402.44 g/mol. Its IUPAC name is [(2'S,6'S,7S)-2'-methyl-6'-(1-methyltriazol-4-yl)-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-3-yl]methanol.
| Compound Name | [(2'S,6'S,7S)-2'-methyl-6'-(1-methyltriazol-4-yl)-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-3-yl]methanol |
|---|---|
| PubChem CID | 164725532 |
| Molecular Formula | C17H21F3N4O2S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(2'S,6'S,7S)-2'-methyl-6'-(1-methyltriazol-4-yl)-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-3-yl]methanol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(C)nn3)N1)OCCc1c2sc(C(F)(F)F)c1CO |
| InChI | InChI=1S/C17H21F3N4O2S/c1-9-5-16(6-12(21-9)13-7-24(2)23-22-13)14-10(3-4-26-16)11(8-25)15(27-14)17(18,19)20/h7,9,12,21,25H,3-6,8H2,1-2H3/t9-,12-,16-/m0/s1 |
| InChIKey | VRACAZSNIATUQH-HCYDYPBKSA-N |
| XLogP | 2.67 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |