C6H10OSe — CID 164804759
5,6-dimethyl-2,3-dihydro-1,4-oxaselenine (PubChem CID 164804759) has the molecular formula C6H10OSe and a molecular weight of 177.10 g/mol. Its IUPAC name is 5,6-dimethyl-2,3-dihydro-1,4-oxaselenine.
| Compound Name | 5,6-dimethyl-2,3-dihydro-1,4-oxaselenine |
|---|---|
| PubChem CID | 164804759 |
| Molecular Formula | C6H10OSe |
| Molecular Weight | 177.10 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 5,6-dimethyl-2,3-dihydro-1,4-oxaselenine |
| SMILES | CC1=C(C)[Se]CCO1 |
| InChI | InChI=1S/C6H10OSe/c1-5-6(2)8-4-3-7-5/h3-4H2,1-2H3 |
| InChIKey | CGNVATVLMDRFPM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.10 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|