C12H22O3 — CID 171575829
(2S,3R,6Z)-2,3,6,7-tetramethyl-1,4,8-trioxacycloundec-6-ene (PubChem CID 171575829) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2S,3R,6Z)-2,3,6,7-tetramethyl-1,4,8-trioxacycloundec-6-ene.
| Compound Name | (2S,3R,6Z)-2,3,6,7-tetramethyl-1,4,8-trioxacycloundec-6-ene |
|---|---|
| PubChem CID | 171575829 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2S,3R,6Z)-2,3,6,7-tetramethyl-1,4,8-trioxacycloundec-6-ene |
| SMILES | C/C1=C(\C)OCCCO[C@@H](C)[C@@H](C)OC1 |
| InChI | InChI=1S/C12H22O3/c1-9-8-15-12(4)11(3)14-7-5-6-13-10(9)2/h11-12H,5-8H2,1-4H3/b10-9-/t11-,12+/m0/s1 |
| InChIKey | MSYNXSCUMKCPHL-QMZLHQMTSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |