C22H41N11O8 — CID 164822318
tert-butyl N-[2-[2-[[1,3-bis(3-azidopropoxy)-2-(3-azidopropoxymethyl)propan-2-yl]amino]-2-oxoethoxy]ethoxy]carbamate (PubChem CID 164822318) has the molecular formula C22H41N11O8 and a molecular weight of 587.64 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[1,3-bis(3-azidopropoxy)-2-(3-azidopropoxymethyl)propan-2-yl]amino]-2-oxoethoxy]ethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[1,3-bis(3-azidopropoxy)-2-(3-azidopropoxymethyl)propan-2-yl]amino]-2-oxoethoxy]ethoxy]carbamate |
|---|---|
| PubChem CID | 164822318 |
| Molecular Formula | C22H41N11O8 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | tert-butyl N-[2-[2-[[1,3-bis(3-azidopropoxy)-2-(3-azidopropoxymethyl)propan-2-yl]amino]-2-oxoethoxy]ethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCCOCC(=O)NC(COCCCN=[N+]=[N-])(COCCCN=[N+]=[N-])COCCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H41N11O8/c1-21(2,3)41-20(35)30-40-14-13-36-15-19(34)29-22(16-37-10-4-7-26-31-23,17-38-11-5-8-27-32-24)18-39-12-6-9-28-33-25/h4-18H2,1-3H3,(H,29,34)(H,30,35) |
| InChIKey | AYULEZJQSKGGEY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 259.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|