C17H34BN5O7S — CID 164837925
(3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-piperidin-4-ylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837925) has the molecular formula C17H34BN5O7S and a molecular weight of 463.37 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-piperidin-4-ylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-piperidin-4-ylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837925 |
| Molecular Formula | C17H34BN5O7S |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (3R,4S)-3-amino-1-[(4-aminooxolan-3-yl)-piperidin-4-ylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC1COCC1N(C1CCNCC1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C17H34BN5O7S/c19-14-9-30-10-15(14)23(13-3-6-21-7-4-13)31(28,29)22-8-12(2-1-5-18(26)27)17(20,11-22)16(24)25/h12-15,21,26-27H,1-11,19-20H2,(H,24,25)/t12-,14?,15?,17-/m0/s1 |
| InChIKey | CDXTXNNXHLCDAZ-AIDBPNLOSA-N |
| XLogP | -3.02 |
| TPSA | 191.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|