C32H51NO4Si — CID 164848358
(3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]azetidin-2-one (PubChem CID 164848358) has the molecular formula C32H51NO4Si and a molecular weight of 541.85 g/mol. Its IUPAC name is (3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]azetidin-2-one.
| Compound Name | (3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]azetidin-2-one |
|---|---|
| PubChem CID | 164848358 |
| Molecular Formula | C32H51NO4Si |
| Molecular Weight | 541.85 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | (3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]azetidin-2-one |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H51NO4Si/c1-11-12-13-14-23-18-26(34)29(25-17-21(4)15-16-24(25)20(2)3)27(19-23)36-31-28(30(35)33-31)22(5)37-38(9,10)32(6,7)8/h17-19,22,24-25,28,31,34H,2,11-16H2,1,3-10H3,(H,33,35)/t22-,24+,25-,28+,31?/m1/s1 |
| InChIKey | NJRKDARUSYBAFS-AMYVAORISA-N |
| XLogP | 8.00 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.85 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|