C12H13N3O2 — CID 164873406
5-amino-3-(3,6-dihydro-2H-1,4-oxazin-5-yl)-1H-indol-2-ol (PubChem CID 164873406) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-amino-3-(3,6-dihydro-2H-1,4-oxazin-5-yl)-1H-indol-2-ol.
| Compound Name | 5-amino-3-(3,6-dihydro-2H-1,4-oxazin-5-yl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 164873406 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-amino-3-(3,6-dihydro-2H-1,4-oxazin-5-yl)-1H-indol-2-ol |
| SMILES | Nc1ccc2[nH]c(O)c(C3=NCCOC3)c2c1 |
| InChI | InChI=1S/C12H13N3O2/c13-7-1-2-9-8(5-7)11(12(16)15-9)10-6-17-4-3-14-10/h1-2,5,15-16H,3-4,6,13H2 |
| InChIKey | HHRPLUQZJHBFBT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|