C21H30N3Si+ — CID 164933534
[8-(diethylamino)-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene]-ethyl-methylazanium (PubChem CID 164933534) has the molecular formula C21H30N3Si+ and a molecular weight of 352.58 g/mol. Its IUPAC name is [8-(diethylamino)-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene]-ethyl-methylazanium.
| Compound Name | [8-(diethylamino)-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene]-ethyl-methylazanium |
|---|---|
| PubChem CID | 164933534 |
| Molecular Formula | C21H30N3Si+ |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [8-(diethylamino)-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene]-ethyl-methylazanium |
| SMILES | CCN(CC)c1ccc2c(c1)[Si](C)(C)C1=C/C(=[N+](\C)CC)C=CC1=N2 |
| InChI | InChI=1S/C21H30N3Si/c1-7-23(4)16-10-12-18-20(14-16)25(5,6)21-15-17(24(8-2)9-3)11-13-19(21)22-18/h10-15H,7-9H2,1-6H3/q+1 |
| InChIKey | ZUPLVBLEHNQJSX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|