C21H27N3O2Si — CID 174030355
4-[8-(dimethylamino)-2-ethylimino-10-methylbenzo[b][1,4]benzazasilin-10-yl]butanoic acid (PubChem CID 174030355) has the molecular formula C21H27N3O2Si and a molecular weight of 381.55 g/mol. Its IUPAC name is 4-[8-(dimethylamino)-2-ethylimino-10-methylbenzo[b][1,4]benzazasilin-10-yl]butanoic acid.
| Compound Name | 4-[8-(dimethylamino)-2-ethylimino-10-methylbenzo[b][1,4]benzazasilin-10-yl]butanoic acid |
|---|---|
| PubChem CID | 174030355 |
| Molecular Formula | C21H27N3O2Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-[8-(dimethylamino)-2-ethylimino-10-methylbenzo[b][1,4]benzazasilin-10-yl]butanoic acid |
| SMILES | CC/N=C1\C=CC2=Nc3ccc(N(C)C)cc3[Si](C)(CCCC(=O)O)C2=C1 |
| InChI | InChI=1S/C21H27N3O2Si/c1-5-22-15-8-10-17-19(13-15)27(4,12-6-7-21(25)26)20-14-16(24(2)3)9-11-18(20)23-17/h8-11,13-14H,5-7,12H2,1-4H3,(H,25,26)/b22-15+ |
| InChIKey | XGPIXXHAUGRITM-PXLXIMEGSA-N |
| XLogP | 3.49 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|