C13H18NO13P3 — CID 164938518
[[(2R,3R,5R)-5-(4-cyano-2-methoxyphenyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 164938518) has the molecular formula C13H18NO13P3 and a molecular weight of 489.20 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(4-cyano-2-methoxyphenyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-(4-cyano-2-methoxyphenyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 164938518 |
| Molecular Formula | C13H18NO13P3 |
| Molecular Weight | 489.20 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | [[(2R,3R,5R)-5-(4-cyano-2-methoxyphenyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COc1cc(C#N)ccc1[C@H]1C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C13H18NO13P3/c1-23-11-4-8(6-14)2-3-9(11)12-5-10(15)13(25-12)7-24-29(19,20)27-30(21,22)26-28(16,17)18/h2-4,10,12-13,15H,5,7H2,1H3,(H,19,20)(H,21,22)(H2,16,17,18)/t10-,12-,13-/m1/s1 |
| InChIKey | LMCXNCRDJSWOCK-RAIGVLPGSA-N |
| XLogP | 1.10 |
| TPSA | 222.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|