C18H20N6O — CID 164966834
17-(methylamino)-5-methylidene-2,6,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,7(21),13(20),14,17-hexaen-12-one (PubChem CID 164966834) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 17-(methylamino)-5-methylidene-2,6,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,7(21),13(20),14,17-hexaen-12-one.
| Compound Name | 17-(methylamino)-5-methylidene-2,6,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,7(21),13(20),14,17-hexaen-12-one |
|---|---|
| PubChem CID | 164966834 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 17-(methylamino)-5-methylidene-2,6,15,16,19-pentazatetracyclo[11.5.2.13,7.016,20]henicosa-1(19),3,7(21),13(20),14,17-hexaen-12-one |
| SMILES | C=C1C=C2C=C(CCCCC(=O)c3cnn4c(NC)cc(nc34)N2)N1 |
| InChI | InChI=1S/C18H20N6O/c1-11-7-13-8-12(21-11)5-3-4-6-15(25)14-10-20-24-17(19-2)9-16(22-13)23-18(14)24/h7-10,19,21H,1,3-6H2,2H3,(H,22,23) |
| InChIKey | MVXOTNRRDRAHQJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |