C16H18N6O — CID 164948010
16-(methylamino)-2,6,14,15,18-pentazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one (PubChem CID 164948010) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 16-(methylamino)-2,6,14,15,18-pentazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one.
| Compound Name | 16-(methylamino)-2,6,14,15,18-pentazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one |
|---|---|
| PubChem CID | 164948010 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 16-(methylamino)-2,6,14,15,18-pentazatetracyclo[10.5.2.13,6.015,19]icosa-1(18),3(20),4,12(19),13,16-hexaen-11-one |
| SMILES | CNc1cc2nc3c(cnn13)C(=O)CCCCn1ccc(c1)N2 |
| InChI | InChI=1S/C16H18N6O/c1-17-15-8-14-19-11-5-7-21(10-11)6-3-2-4-13(23)12-9-18-22(15)16(12)20-14/h5,7-10,17H,2-4,6H2,1H3,(H,19,20) |
| InChIKey | LHUYTCBGGWJAMD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |