C23H25NO3S — CID 164969833
3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]-N-hydroxypropanamide (PubChem CID 164969833) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is 3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]-N-hydroxypropanamide.
| Compound Name | 3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 164969833 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]-N-hydroxypropanamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Cc2ccc3sc(CCC(=O)NO)cc3c2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-23(2,3)18-7-5-16(6-8-18)20(25)13-15-4-10-21-17(12-15)14-19(28-21)9-11-22(26)24-27/h4-8,10,12,14,27H,9,11,13H2,1-3H3,(H,24,26) |
| InChIKey | CYXBJOWWEXXICE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|