C23H24N2O2S — CID 165050636
(E)-3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]prop-2-enehydrazide (PubChem CID 165050636) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (E)-3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]prop-2-enehydrazide.
| Compound Name | (E)-3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 165050636 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (E)-3-[5-[2-(4-tert-butylphenyl)-2-oxoethyl]-1-benzothiophen-2-yl]prop-2-enehydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)Cc2ccc3sc(/C=C/C(=O)NN)cc3c2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-23(2,3)18-7-5-16(6-8-18)20(26)13-15-4-10-21-17(12-15)14-19(28-21)9-11-22(27)25-24/h4-12,14H,13,24H2,1-3H3,(H,25,27)/b11-9+ |
| InChIKey | PPJZHNVHYQVPAJ-PKNBQFBNSA-N |
| XLogP | 4.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|