C14H10F18O4 — CID 165164937
1,1,1,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]propoxy]hept-6-en-3-ol (PubChem CID 165164937) has the molecular formula C14H10F18O4 and a molecular weight of 584.19 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]propoxy]hept-6-en-3-ol.
| Compound Name | 1,1,1,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]propoxy]hept-6-en-3-ol |
|---|---|
| PubChem CID | 165164937 |
| Molecular Formula | C14H10F18O4 |
| Molecular Weight | 584.19 g/mol |
| Exact Mass | 584.03 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethoxy]propoxy]hept-6-en-3-ol |
| SMILES | C=CCCC(O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)OC(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10F18O4/c1-2-3-4-5(33)7(16,10(21,22)23)35-12(27,28)9(20,11(24,25)26)36-14(31,32)13(29,30)34-6(15)8(17,18)19/h2,5-6,33H,1,3-4H2 |
| InChIKey | QTFQIJBNLZXPBP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.19 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|