C16H19N4O10P — CID 165353371
[2,3,4-trihydroxy-5-(7-methyl-2,4,8-trioxo-1H-benzo[g]pteridin-10-yl)pentyl] dihydrogen phosphate (PubChem CID 165353371) has the molecular formula C16H19N4O10P and a molecular weight of 458.32 g/mol. Its IUPAC name is [2,3,4-trihydroxy-5-(7-methyl-2,4,8-trioxo-1H-benzo[g]pteridin-10-yl)pentyl] dihydrogen phosphate.
| Compound Name | [2,3,4-trihydroxy-5-(7-methyl-2,4,8-trioxo-1H-benzo[g]pteridin-10-yl)pentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 165353371 |
| Molecular Formula | C16H19N4O10P |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [2,3,4-trihydroxy-5-(7-methyl-2,4,8-trioxo-1H-benzo[g]pteridin-10-yl)pentyl] dihydrogen phosphate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)[nH]c3n(CC(O)C(O)C(O)COP(=O)(O)O)c-2cc1=O |
| InChI | InChI=1S/C16H19N4O10P/c1-6-2-7-8(3-9(6)21)20(14-12(17-7)15(25)19-16(26)18-14)4-10(22)13(24)11(23)5-30-31(27,28)29/h2-3,10-11,13,22-24H,4-5H2,1H3,(H2,27,28,29)(H2,18,19,25,26) |
| InChIKey | FRQUOUOVATXBAB-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 228.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|