C9H10Cl3N — CID 165372044
2-tert-butyl-3,4,6-trichloropyridine (PubChem CID 165372044) has the molecular formula C9H10Cl3N and a molecular weight of 238.54 g/mol. Its IUPAC name is 2-tert-butyl-3,4,6-trichloropyridine.
| Compound Name | 2-tert-butyl-3,4,6-trichloropyridine |
|---|---|
| PubChem CID | 165372044 |
| Molecular Formula | C9H10Cl3N |
| Molecular Weight | 238.54 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 2-tert-butyl-3,4,6-trichloropyridine |
| SMILES | CC(C)(C)c1nc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl3N/c1-9(2,3)8-7(12)5(10)4-6(11)13-8/h4H,1-3H3 |
| InChIKey | YHIRHIUSJOGHDW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|