C16H19ClO2S — CID 165387181
1-[2-[3-(chloromethyl)-2,2-dimethylcyclobutylidene]ethenylsulfonyl]-4-methylbenzene (PubChem CID 165387181) has the molecular formula C16H19ClO2S and a molecular weight of 310.85 g/mol. Its IUPAC name is 1-[2-[3-(chloromethyl)-2,2-dimethylcyclobutylidene]ethenylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[2-[3-(chloromethyl)-2,2-dimethylcyclobutylidene]ethenylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 165387181 |
| Molecular Formula | C16H19ClO2S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-[2-[3-(chloromethyl)-2,2-dimethylcyclobutylidene]ethenylsulfonyl]-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C=C=C2CC(CCl)C2(C)C)cc1 |
| InChI | InChI=1S/C16H19ClO2S/c1-12-4-6-15(7-5-12)20(18,19)9-8-13-10-14(11-17)16(13,2)3/h4-7,9,14H,10-11H2,1-3H3 |
| InChIKey | IGHXLVNBMMKJFX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|