C11H21N3O3S — CID 165452330
1-[(1,1-dioxo-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4a-yl)methyl]-3-ethylurea (PubChem CID 165452330) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-[(1,1-dioxo-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4a-yl)methyl]-3-ethylurea.
| Compound Name | 1-[(1,1-dioxo-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4a-yl)methyl]-3-ethylurea |
|---|---|
| PubChem CID | 165452330 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[(1,1-dioxo-3,4,5,6,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4a-yl)methyl]-3-ethylurea |
| SMILES | CCNC(=O)NCC12CCCS(=O)(=O)C1CNC2 |
| InChI | InChI=1S/C11H21N3O3S/c1-2-13-10(15)14-8-11-4-3-5-18(16,17)9(11)6-12-7-11/h9,12H,2-8H2,1H3,(H2,13,14,15) |
| InChIKey | KMMJIZLNNCJYHQ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |