C22H32O4 — CID 166012036
methyl (1R,2R)-2-(2,6-dimethoxy-4-pentylphenyl)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate (PubChem CID 166012036) has the molecular formula C22H32O4 and a molecular weight of 363.51 g/mol. Its IUPAC name is methyl (1R,2R)-2-(2,6-dimethoxy-4-pentylphenyl)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R)-2-(2,6-dimethoxy-4-pentylphenyl)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 166012036 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | methyl (1R,2R)-2-(2,6-dimethoxy-4-pentylphenyl)-4-(trideuteriomethyl)cyclohex-3-ene-1-carboxylate |
| SMILES | [2H]C([2H])([2H])C1=C[C@@H](c2c(OC)cc(CCCCC)cc2OC)[C@H](C(=O)OC)CC1 |
| InChI | InChI=1S/C22H32O4/c1-6-7-8-9-16-13-19(24-3)21(20(14-16)25-4)18-12-15(2)10-11-17(18)22(23)26-5/h12-14,17-18H,6-11H2,1-5H3/t17-,18-/m1/s1/i2D3 |
| InChIKey | QSZXGCRYWVMGQJ-VYJABQBDSA-N |
| XLogP | 5.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|