C39H29N3Si — CID 166055433
2-(5,5-dimethylnaphtho[2,3-b][1]benzosilol-1-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5-tetradeuteriophenyl)phenyl]-1,3,5-triazine (PubChem CID 166055433) has the molecular formula C39H29N3Si and a molecular weight of 580.85 g/mol. Its IUPAC name is 2-(5,5-dimethylnaphtho[2,3-b][1]benzosilol-1-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5-tetradeuteriophenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(5,5-dimethylnaphtho[2,3-b][1]benzosilol-1-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5-tetradeuteriophenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166055433 |
| Molecular Formula | C39H29N3Si |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | 2-(5,5-dimethylnaphtho[2,3-b][1]benzosilol-1-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5-tetradeuteriophenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1cc(-c2c([2H])c([2H])c(-c3nc(-c4cccc5c4-c4cc6ccccc6cc4[Si]5(C)C)nc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])n3)c([2H])c2[2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C39H29N3Si/c1-43(2)34-19-11-18-32(36(34)33-24-30-16-9-10-17-31(30)25-35(33)43)39-41-37(28-14-7-4-8-15-28)40-38(42-39)29-22-20-27(21-23-29)26-12-5-3-6-13-26/h3-25H,1-2H3/i3D,4D,5D,6D,7D,8D,12D,14D,15D,20D,21D,22D,23D |
| InChIKey | GEFIEQXZRWMKKQ-KPVOYZSUSA-N |
| XLogP | 8.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|