C14H21FN4OS — CID 166085091
4-(5-amino-1,3,4-thiadiazol-2-yl)-2-fluorobenzaldehyde;N,N-dimethylmethanamine;ethane (PubChem CID 166085091) has the molecular formula C14H21FN4OS and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-(5-amino-1,3,4-thiadiazol-2-yl)-2-fluorobenzaldehyde;N,N-dimethylmethanamine;ethane.
| Compound Name | 4-(5-amino-1,3,4-thiadiazol-2-yl)-2-fluorobenzaldehyde;N,N-dimethylmethanamine;ethane |
|---|---|
| PubChem CID | 166085091 |
| Molecular Formula | C14H21FN4OS |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-(5-amino-1,3,4-thiadiazol-2-yl)-2-fluorobenzaldehyde;N,N-dimethylmethanamine;ethane |
| SMILES | CC.CN(C)C.Nc1nnc(-c2ccc(C=O)c(F)c2)s1 |
| InChI | InChI=1S/C9H6FN3OS.C3H9N.C2H6/c10-7-3-5(1-2-6(7)4-14)8-12-13-9(11)15-8;1-4(2)3;1-2/h1-4H,(H2,11,13);1-3H3;1-2H3 |
| InChIKey | UIZSOHBMVSDTAP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|