C24H32N2O4 — CID 166100518
(2S)-N-(8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-ylidene)oxolane-2-carboxamide (PubChem CID 166100518) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2S)-N-(8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-ylidene)oxolane-2-carboxamide.
| Compound Name | (2S)-N-(8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-ylidene)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166100518 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (2S)-N-(8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-trien-14-ylidene)oxolane-2-carboxamide |
| SMILES | O=C(/N=C1\CCN2CCOc3ccccc3C3CCC(CC3)OCC12)[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H32N2O4/c27-24(23-6-3-14-28-23)25-20-11-12-26-13-15-29-22-5-2-1-4-19(22)17-7-9-18(10-8-17)30-16-21(20)26/h1-2,4-5,17-18,21,23H,3,6-16H2/b25-20+/t17?,18?,21?,23-/m0/s1 |
| InChIKey | ISDUNIUBLNVQPF-JITZAOGESA-N |
| XLogP | 3.34 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|