C22H31BN2O4 — CID 166109052
1'-(oxan-2-yl)-4'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclopentane-1,3'-pyrrolo[2,3-b]pyridine]-2'-one (PubChem CID 166109052) has the molecular formula C22H31BN2O4 and a molecular weight of 398.31 g/mol. Its IUPAC name is 1'-(oxan-2-yl)-4'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclopentane-1,3'-pyrrolo[2,3-b]pyridine]-2'-one.
| Compound Name | 1'-(oxan-2-yl)-4'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclopentane-1,3'-pyrrolo[2,3-b]pyridine]-2'-one |
|---|---|
| PubChem CID | 166109052 |
| Molecular Formula | C22H31BN2O4 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1'-(oxan-2-yl)-4'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclopentane-1,3'-pyrrolo[2,3-b]pyridine]-2'-one |
| SMILES | CC1(C)OB(c2ccnc3c2C2(CCCC2)C(=O)N3C2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C22H31BN2O4/c1-20(2)21(3,4)29-23(28-20)15-10-13-24-18-17(15)22(11-6-7-12-22)19(26)25(18)16-9-5-8-14-27-16/h10,13,16H,5-9,11-12,14H2,1-4H3 |
| InChIKey | RLICIXIMXYUNLQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|