C15H18N2O3 — CID 166143335
4-(6-methyl-3-oxo-1H-isoindol-2-yl)-8-oxa-2-azabicyclo[5.1.0]octan-3-one;molecular hydrogen (PubChem CID 166143335) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(6-methyl-3-oxo-1H-isoindol-2-yl)-8-oxa-2-azabicyclo[5.1.0]octan-3-one;molecular hydrogen.
| Compound Name | 4-(6-methyl-3-oxo-1H-isoindol-2-yl)-8-oxa-2-azabicyclo[5.1.0]octan-3-one;molecular hydrogen |
|---|---|
| PubChem CID | 166143335 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-(6-methyl-3-oxo-1H-isoindol-2-yl)-8-oxa-2-azabicyclo[5.1.0]octan-3-one;molecular hydrogen |
| SMILES | Cc1ccc2c(c1)CN(C1CCC3OC3NC1=O)C2=O.[H][H] |
| InChI | InChI=1S/C15H16N2O3.H2/c1-8-2-3-10-9(6-8)7-17(15(10)19)11-4-5-12-14(20-12)16-13(11)18;/h2-3,6,11-12,14H,4-5,7H2,1H3,(H,16,18);1H |
| InChIKey | RHYONBBWCWVQHT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|