C9H6Br2N2O2 — CID 166150349
7,9-dibromo-4-methyl-1H-pyrido[1,2-a]pyrimidine-2,8-dione (PubChem CID 166150349) has the molecular formula C9H6Br2N2O2 and a molecular weight of 333.97 g/mol. Its IUPAC name is 7,9-dibromo-4-methyl-1H-pyrido[1,2-a]pyrimidine-2,8-dione.
| Compound Name | 7,9-dibromo-4-methyl-1H-pyrido[1,2-a]pyrimidine-2,8-dione |
|---|---|
| PubChem CID | 166150349 |
| Molecular Formula | C9H6Br2N2O2 |
| Molecular Weight | 333.97 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | 7,9-dibromo-4-methyl-1H-pyrido[1,2-a]pyrimidine-2,8-dione |
| SMILES | Cc1cc(=O)[nH]c2c(Br)c(=O)c(Br)cn12 |
| InChI | InChI=1S/C9H6Br2N2O2/c1-4-2-6(14)12-9-7(11)8(15)5(10)3-13(4)9/h2-3H,1H3,(H,12,14) |
| InChIKey | FHDKIZQLJKAGEK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.97 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |