C38H56N6O7 — CID 166157852
2-[[(11Z)-12-amino-5-[4-[2-(3-methoxy-3-methylbutoxy)propylamino]-4-oxobutanoyl]-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl N-[5-(methylamino)-6-oxohexyl]carbamate (PubChem CID 166157852) has the molecular formula C38H56N6O7 and a molecular weight of 708.90 g/mol. Its IUPAC name is 2-[[(11Z)-12-amino-5-[4-[2-(3-methoxy-3-methylbutoxy)propylamino]-4-oxobutanoyl]-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl N-[5-(methylamino)-6-oxohexyl]carbamate.
| Compound Name | 2-[[(11Z)-12-amino-5-[4-[2-(3-methoxy-3-methylbutoxy)propylamino]-4-oxobutanoyl]-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl N-[5-(methylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 166157852 |
| Molecular Formula | C38H56N6O7 |
| Molecular Weight | 708.90 g/mol |
| Exact Mass | 708.42 |
| IUPAC Name | 2-[[(11Z)-12-amino-5-[4-[2-(3-methoxy-3-methylbutoxy)propylamino]-4-oxobutanoyl]-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl N-[5-(methylamino)-6-oxohexyl]carbamate |
| SMILES | CNC(C=O)CCCCNC(=O)OCCN/C1=C(\N)c2ccccc2N(C(=O)CCC(=O)NCC(C)OCCC(C)(C)OC)Cc2ccccc21 |
| InChI | InChI=1S/C38H56N6O7/c1-27(50-22-19-38(2,3)49-5)24-43-33(46)17-18-34(47)44-25-28-12-6-7-14-30(28)36(35(39)31-15-8-9-16-32(31)44)41-21-23-51-37(48)42-20-11-10-13-29(26-45)40-4/h6-9,12,14-16,26-27,29,40-41H,10-11,13,17-25,39H2,1-5H3,(H,42,48)(H,43,46)/b36-35- |
| InChIKey | CTJUYYLTBWTGDT-KXYMVQBMSA-N |
| XLogP | 3.71 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|