C24H28F5N3O5 — CID 166160391
(2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(3-methoxyazetidin-1-yl)ethoxy]phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160391) has the molecular formula C24H28F5N3O5 and a molecular weight of 533.49 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(3-methoxyazetidin-1-yl)ethoxy]phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(3-methoxyazetidin-1-yl)ethoxy]phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160391 |
| Molecular Formula | C24H28F5N3O5 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-[2-(3-methoxyazetidin-1-yl)ethoxy]phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COC1CN(CCOc2c([C@H]3[C@H](C(=O)Nc4conc4C)O[C@@](C)(C(F)(F)F)[C@H]3C)ccc(F)c2F)C1 |
| InChI | InChI=1S/C24H28F5N3O5/c1-12-18(15-5-6-16(25)19(26)20(15)35-8-7-32-9-14(10-32)34-4)21(37-23(12,3)24(27,28)29)22(33)30-17-11-36-31-13(17)2/h5-6,11-12,14,18,21H,7-10H2,1-4H3,(H,30,33)/t12-,18-,21+,23+/m0/s1 |
| InChIKey | HREMRQNVHQNCSR-IUCRBNCASA-N |
| XLogP | 4.05 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |