C20H21F5N2O5 — CID 166160183
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160183) has the molecular formula C20H21F5N2O5 and a molecular weight of 464.39 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160183 |
| Molecular Formula | C20H21F5N2O5 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(3-methyl-1,2-oxazol-4-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | Cc1nocc1NC(=O)[C@@H]1O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]1c1ccc(F)c(F)c1OCCO |
| InChI | InChI=1S/C20H21F5N2O5/c1-9-14(11-4-5-12(21)15(22)16(11)30-7-6-28)17(32-19(9,3)20(23,24)25)18(29)26-13-8-31-27-10(13)2/h4-5,8-9,14,17,28H,6-7H2,1-3H3,(H,26,29)/t9-,14-,17+,19+/m0/s1 |
| InChIKey | DBQBGYVZYSYKTG-IUWPEGGASA-N |
| XLogP | 3.71 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |