C17H17ClN2O2S — CID 166248231
6-chloro-4-(3-imidazol-1-ylpropylsulfanylmethyl)-7-methylchromen-2-one (PubChem CID 166248231) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 6-chloro-4-(3-imidazol-1-ylpropylsulfanylmethyl)-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-(3-imidazol-1-ylpropylsulfanylmethyl)-7-methylchromen-2-one |
|---|---|
| PubChem CID | 166248231 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6-chloro-4-(3-imidazol-1-ylpropylsulfanylmethyl)-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSCCCn3ccnc3)c2cc1Cl |
| InChI | InChI=1S/C17H17ClN2O2S/c1-12-7-16-14(9-15(12)18)13(8-17(21)22-16)10-23-6-2-4-20-5-3-19-11-20/h3,5,7-9,11H,2,4,6,10H2,1H3 |
| InChIKey | JLUYDLMLWUVWHO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|