C17H23NO6 — CID 166284045
(5-oxooxolan-2-yl)methyl 6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 166284045) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is (5-oxooxolan-2-yl)methyl 6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (5-oxooxolan-2-yl)methyl 6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 166284045 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (5-oxooxolan-2-yl)methyl 6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C1CCC(COC(=O)C2CC=CCC2C(=O)N2CCOCC2)O1 |
| InChI | InChI=1S/C17H23NO6/c19-15-6-5-12(24-15)11-23-17(21)14-4-2-1-3-13(14)16(20)18-7-9-22-10-8-18/h1-2,12-14H,3-11H2 |
| InChIKey | IYYWZLXNPCGWBP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|