C11H16F3N2O3PS — CID 166295575
N-(3-dimethylphosphorylpropyl)-5-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 166295575) has the molecular formula C11H16F3N2O3PS and a molecular weight of 344.30 g/mol. Its IUPAC name is N-(3-dimethylphosphorylpropyl)-5-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | N-(3-dimethylphosphorylpropyl)-5-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 166295575 |
| Molecular Formula | C11H16F3N2O3PS |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-(3-dimethylphosphorylpropyl)-5-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | CP(C)(=O)CCCNS(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H16F3N2O3PS/c1-20(2,17)7-3-6-16-21(18,19)10-5-4-9(8-15-10)11(12,13)14/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | HHZAPTOGXLTFHN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|