C13H13F3N4O3S — CID 166333920
3-amino-1-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]sulfonylpyrazole-5-carboxamide (PubChem CID 166333920) has the molecular formula C13H13F3N4O3S and a molecular weight of 362.33 g/mol. Its IUPAC name is 3-amino-1-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]sulfonylpyrazole-5-carboxamide.
| Compound Name | 3-amino-1-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]sulfonylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166333920 |
| Molecular Formula | C13H13F3N4O3S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-amino-1-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]sulfonylpyrazole-5-carboxamide |
| SMILES | Cc1c(C(F)(F)F)cccc1S(=O)(=O)NC(=O)c1cc(N)nn1C |
| InChI | InChI=1S/C13H13F3N4O3S/c1-7-8(13(14,15)16)4-3-5-10(7)24(22,23)19-12(21)9-6-11(17)18-20(9)2/h3-6H,1-2H3,(H2,17,18)(H,19,21) |
| InChIKey | UUJZDMUTBZTVDJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |