About N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide
N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide (PubChem CID 166371367) has the molecular formula C12H8F5NO2S2
and a molecular weight of 357.33 g/mol. Its IUPAC name is N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide.
Molecular Properties
| Compound Name | N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide |
| PubChem CID | 166371367 |
| Molecular Formula | C12H8F5NO2S2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCc1c(F)cc(C(F)(F)F)cc1F)c1ccsc1 |
| InChI | InChI=1S/C12H8F5NO2S2/c13-10-3-7(12(15,16)17)4-11(14)9(10)5-18-22(19,20)8-1-2-21-6-8/h1-4,6,18H,5H2 |
| InChIKey | HNBJMUHQYHRKBF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide?
The IUPAC name of N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide (CID 166371367) is N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide.
What is the SMILES notation for N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide?
The canonical SMILES for N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide is O=S(=O)(NCc1c(F)cc(C(F)(F)F)cc1F)c1ccsc1.
What is the InChIKey of N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide?
The InChIKey is HNBJMUHQYHRKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F5NO2S2/c13-10-3-7(12(15,16)17)4-11(14)9(10)5-18-22(19,20)8-1-2-21-6-8/h1-4,6,18H,5H2.
What are the key properties of N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide?
N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide has a molecular weight of 357.33 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,6-difluoro-4-(trifluoromethyl)phenyl]methyl]thiophene-3-sulfonamide is sourced from PubChem (CID 166371367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).