C15H16N8O2 — CID 166402055
3-[3-[3-(6-aminopurin-9-yl)azetidin-1-yl]-3-oxopropyl]pyrimidin-4-one (PubChem CID 166402055) has the molecular formula C15H16N8O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-[3-[3-(6-aminopurin-9-yl)azetidin-1-yl]-3-oxopropyl]pyrimidin-4-one.
| Compound Name | 3-[3-[3-(6-aminopurin-9-yl)azetidin-1-yl]-3-oxopropyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 166402055 |
| Molecular Formula | C15H16N8O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[3-[3-(6-aminopurin-9-yl)azetidin-1-yl]-3-oxopropyl]pyrimidin-4-one |
| SMILES | Nc1ncnc2c1ncn2C1CN(C(=O)CCn2cnccc2=O)C1 |
| InChI | InChI=1S/C15H16N8O2/c16-14-13-15(19-7-18-14)23(9-20-13)10-5-22(6-10)12(25)2-4-21-8-17-3-1-11(21)24/h1,3,7-10H,2,4-6H2,(H2,16,18,19) |
| InChIKey | WRJVVLGFXZPXFL-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 124.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |