C18H18F2N2O — CID 166432349
N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylbicyclo[1.1.0]butane-1-carboxamide (PubChem CID 166432349) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylbicyclo[1.1.0]butane-1-carboxamide.
| Compound Name | N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylbicyclo[1.1.0]butane-1-carboxamide |
|---|---|
| PubChem CID | 166432349 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(6,8-difluoro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-N-methylbicyclo[1.1.0]butane-1-carboxamide |
| SMILES | CN(C(=O)C12CC1C2)C1CCc2[nH]c3c(F)cc(F)cc3c2C1 |
| InChI | InChI=1S/C18H18F2N2O/c1-22(17(23)18-7-9(18)8-18)11-2-3-15-12(6-11)13-4-10(19)5-14(20)16(13)21-15/h4-5,9,11,21H,2-3,6-8H2,1H3 |
| InChIKey | CXRYVNRYMXNQME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|